C45H53N5O8 — CID 10974792
6-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 10974792) has the molecular formula C45H53N5O8 and a molecular weight of 791.95 g/mol. Its IUPAC name is 6-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10974792 |
| Molecular Formula | C45H53N5O8 |
| Molecular Weight | 791.95 g/mol |
| Exact Mass | 791.39 |
| IUPAC Name | 6-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C45H53N5O8/c46-25-11-10-19-38(43(55)49-39(28-31-21-23-32(51)24-22-31)42(54)47-26-12-2-5-20-41(52)53)48-44(56)40(27-30-13-3-1-4-14-30)50-45(57)58-29-37-35-17-8-6-15-33(35)34-16-7-9-18-36(34)37/h1,3-4,6-9,13-18,21-24,37-40,51H,2,5,10-12,19-20,25-29,46H2,(H,47,54)(H,48,56)(H,49,55)(H,50,57)(H,52,53)/t38-,39-,40-/m0/s1 |
| InChIKey | KWUCRDXFQGLWCH-MXVPUGLGSA-N |
| XLogP | 4.94 |
| TPSA | 209.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|