C51H56N2O5S — CID 166703806
cyclooctyl (2S,3S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-methylpentanoate (PubChem CID 166703806) has the molecular formula C51H56N2O5S and a molecular weight of 809.09 g/mol. Its IUPAC name is cyclooctyl (2S,3S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-methylpentanoate.
| Compound Name | cyclooctyl (2S,3S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 166703806 |
| Molecular Formula | C51H56N2O5S |
| Molecular Weight | 809.09 g/mol |
| Exact Mass | 808.39 |
| IUPAC Name | cyclooctyl (2S,3S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC1CCCCCCC1 |
| InChI | InChI=1S/C51H56N2O5S/c1-3-36(2)47(49(55)58-40-28-16-5-4-6-17-29-40)53-48(54)46(52-50(56)57-34-45-43-32-20-18-30-41(43)42-31-19-21-33-44(42)45)35-59-51(37-22-10-7-11-23-37,38-24-12-8-13-25-38)39-26-14-9-15-27-39/h7-15,18-27,30-33,36,40,45-47H,3-6,16-17,28-29,34-35H2,1-2H3,(H,52,56)(H,53,54)/t36-,46-,47-/m0/s1 |
| InChIKey | ABPXUHXYWNEGSW-GKBSYGSLSA-N |
| XLogP | 10.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.09 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|