C24H22NO5P — CID 155823318
3-dimethylphosphoryl-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (PubChem CID 155823318) has the molecular formula C24H22NO5P and a molecular weight of 435.42 g/mol. Its IUPAC name is 3-dimethylphosphoryl-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid.
| Compound Name | 3-dimethylphosphoryl-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 155823318 |
| Molecular Formula | C24H22NO5P |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 3-dimethylphosphoryl-5-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| SMILES | CP(C)(=O)c1cc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc(C(=O)O)c1 |
| InChI | InChI=1S/C24H22NO5P/c1-31(2,29)17-12-15(23(26)27)11-16(13-17)25-24(28)30-14-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h3-13,22H,14H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | MAZHHSJISSDLEE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|