C52H50N4O8 — CID 167688800
9H-fluoren-9-ylmethyl 4-(4-aminophenoxy)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl 4-(4-nitrophenoxy)piperidine-1-carboxylate (PubChem CID 167688800) has the molecular formula C52H50N4O8 and a molecular weight of 858.99 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-(4-aminophenoxy)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl 4-(4-nitrophenoxy)piperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-(4-aminophenoxy)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl 4-(4-nitrophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167688800 |
| Molecular Formula | C52H50N4O8 |
| Molecular Weight | 858.99 g/mol |
| Exact Mass | 858.36 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-(4-aminophenoxy)piperidine-1-carboxylate;9H-fluoren-9-ylmethyl 4-(4-nitrophenoxy)piperidine-1-carboxylate |
| SMILES | Nc1ccc(OC2CCN(C(=O)OCC3c4ccccc4-c4ccccc43)CC2)cc1.O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(Oc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H24N2O5.C26H26N2O3/c29-26(27-15-13-20(14-16-27)33-19-11-9-18(10-12-19)28(30)31)32-17-25-23-7-3-1-5-21(23)22-6-2-4-8-24(22)25;27-18-9-11-19(12-10-18)31-20-13-15-28(16-14-20)26(29)30-17-25-23-7-3-1-5-21(23)22-6-2-4-8-24(22)25/h1-12,20,25H,13-17H2;1-12,20,25H,13-17,27H2 |
| InChIKey | WPPFKGJHXVDDQL-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.99 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|