C27H36N4O8 — CID 161229306
tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate;4-(4-nitrophenoxy)piperidine (PubChem CID 161229306) has the molecular formula C27H36N4O8 and a molecular weight of 544.61 g/mol. Its IUPAC name is tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate;4-(4-nitrophenoxy)piperidine.
| Compound Name | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate;4-(4-nitrophenoxy)piperidine |
|---|---|
| PubChem CID | 161229306 |
| Molecular Formula | C27H36N4O8 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | tert-butyl 4-(4-nitrophenoxy)piperidine-1-carboxylate;4-(4-nitrophenoxy)piperidine |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])cc2)CC1.O=[N+]([O-])c1ccc(OC2CCNCC2)cc1 |
| InChI | InChI=1S/C16H22N2O5.C11H14N2O3/c1-16(2,3)23-15(19)17-10-8-14(9-11-17)22-13-6-4-12(5-7-13)18(20)21;14-13(15)9-1-3-10(4-2-9)16-11-5-7-12-8-6-11/h4-7,14H,8-11H2,1-3H3;1-4,11-12H,5-8H2 |
| InChIKey | UYNQVRFSGPBZMP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 146.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|