C24H37N3O8 — CID 158582888
tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-(4-nitrophenoxy)pyrrolidine-1-carboxylate (PubChem CID 158582888) has the molecular formula C24H37N3O8 and a molecular weight of 495.57 g/mol. Its IUPAC name is tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-(4-nitrophenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-(4-nitrophenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158582888 |
| Molecular Formula | C24H37N3O8 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | tert-butyl 3-hydroxypyrrolidine-1-carboxylate;tert-butyl 3-(4-nitrophenoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C1.CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H20N2O5.C9H17NO3/c1-15(2,3)22-14(18)16-9-8-13(10-16)21-12-6-4-11(5-7-12)17(19)20;1-9(2,3)13-8(12)10-5-4-7(11)6-10/h4-7,13H,8-10H2,1-3H3;7,11H,4-6H2,1-3H3 |
| InChIKey | HTLWBQGUFRHKEG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|