C26H23NO4Se — CID 140685282
Se-(2-formylphenyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropaneselenoate (PubChem CID 140685282) has the molecular formula C26H23NO4Se and a molecular weight of 492.43 g/mol. Its IUPAC name is Se-(2-formylphenyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropaneselenoate.
| Compound Name | Se-(2-formylphenyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropaneselenoate |
|---|---|
| PubChem CID | 140685282 |
| Molecular Formula | C26H23NO4Se |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | Se-(2-formylphenyl) 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropaneselenoate |
| SMILES | CC(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)[Se]c1ccccc1C=O |
| InChI | InChI=1S/C26H23NO4Se/c1-26(2,24(29)32-23-14-8-3-9-17(23)15-28)27-25(30)31-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h3-15,22H,16H2,1-2H3,(H,27,30) |
| InChIKey | KNWRPSXLWSMDKS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|