C29H30N2O5 — CID 90762068
ethane;2-[[1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]benzoic acid (PubChem CID 90762068) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethane;2-[[1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]benzoic acid.
| Compound Name | ethane;2-[[1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 90762068 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | ethane;2-[[1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]benzoic acid |
| SMILES | CC.O=C(O)c1ccccc1NC(=O)C1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H24N2O5.C2H6/c30-25(28-23-13-6-5-12-21(23)26(31)32)24-14-7-15-29(24)27(33)34-16-22-19-10-3-1-8-17(19)18-9-2-4-11-20(18)22;1-2/h1-6,8-13,22,24H,7,14-16H2,(H,28,30)(H,31,32);1-2H3 |
| InChIKey | ALDUIQZVNPTLSF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |