C27H26N2O5 — CID 165486133
2-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]benzoic acid (PubChem CID 165486133) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]benzoic acid.
| Compound Name | 2-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 165486133 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-[[3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]benzoic acid |
| SMILES | CC(C)(CC(=O)Nc1ccccc1C(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H26N2O5/c1-27(2,15-24(30)28-23-14-8-7-13-21(23)25(31)32)29-26(33)34-16-22-19-11-5-3-9-17(19)18-10-4-6-12-20(18)22/h3-14,22H,15-16H2,1-2H3,(H,28,30)(H,29,33)(H,31,32) |
| InChIKey | YTICSOHFJOTUTN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |