C28H35N3O5 — CID 139720894
2-(butylaminomethyl)-3-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 139720894) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-(butylaminomethyl)-3-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 2-(butylaminomethyl)-3-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139720894 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-(butylaminomethyl)-3-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | CCCCNCC(CNC(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C28H35N3O5/c1-2-3-14-29-16-19(27(33)34)17-30-26(32)25-13-8-15-31(25)28(35)36-18-24-22-11-6-4-9-20(22)21-10-5-7-12-23(21)24/h4-7,9-12,19,24-25,29H,2-3,8,13-18H2,1H3,(H,30,32)(H,33,34)/t19?,25-/m0/s1 |
| InChIKey | YLGOZIQQGCWFNF-BIAFCPFJSA-N |
| XLogP | 3.61 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|