C24H27NO5 — CID 142154291
trans-prop-2-enyl (1R,2S)-1-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-2-hydroxycyclopentane-1-carboxylate (PubChem CID 142154291) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is trans-prop-2-enyl (1R,2S)-1-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-2-hydroxycyclopentane-1-carboxylate.
| Compound Name | trans-prop-2-enyl (1R,2S)-1-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-2-hydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 142154291 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | trans-prop-2-enyl (1R,2S)-1-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-2-hydroxycyclopentane-1-carboxylate |
| SMILES | C=CCOC(=O)[C@@]1(NC(O)OCC2c3ccccc3-c3ccccc32)CCC[C@@H]1O |
| InChI | InChI=1S/C24H27NO5/c1-2-14-29-22(27)24(13-7-12-21(24)26)25-23(28)30-15-20-18-10-5-3-8-16(18)17-9-4-6-11-19(17)20/h2-6,8-11,20-21,23,25-26,28H,1,7,12-15H2/t21-,23?,24+/m0/s1 |
| InChIKey | UCYAHTQMAVQOIB-FYFGAKMPSA-N |
| XLogP | 2.69 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|