C28H34F2N2O5 — CID 154936349
tert-butyl (2S)-4-(4,4-difluoropiperidin-1-yl)-2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-oxobutanoate (PubChem CID 154936349) has the molecular formula C28H34F2N2O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is tert-butyl (2S)-4-(4,4-difluoropiperidin-1-yl)-2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-4-(4,4-difluoropiperidin-1-yl)-2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 154936349 |
| Molecular Formula | C28H34F2N2O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | tert-butyl (2S)-4-(4,4-difluoropiperidin-1-yl)-2-[[9H-fluoren-9-ylmethoxy(hydroxy)methyl]amino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)N1CCC(F)(F)CC1)NC(O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H34F2N2O5/c1-27(2,3)37-25(34)23(16-24(33)32-14-12-28(29,30)13-15-32)31-26(35)36-17-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-11,22-23,26,31,35H,12-17H2,1-3H3/t23-,26?/m0/s1 |
| InChIKey | CSPYJTOKKBMWAQ-ZZHFZYNASA-N |
| XLogP | 4.04 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|