C21H27N3O2 — CID 155917065
(6S,7R)-7-methyl-8-[2-(2-methyl-1H-indol-3-yl)acetyl]-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 155917065) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (6S,7R)-7-methyl-8-[2-(2-methyl-1H-indol-3-yl)acetyl]-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | (6S,7R)-7-methyl-8-[2-(2-methyl-1H-indol-3-yl)acetyl]-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 155917065 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (6S,7R)-7-methyl-8-[2-(2-methyl-1H-indol-3-yl)acetyl]-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N1CCC[C@@]2(CCCNC2=O)[C@H]1C |
| InChI | InChI=1S/C21H27N3O2/c1-14-17(16-7-3-4-8-18(16)23-14)13-19(25)24-12-6-10-21(15(24)2)9-5-11-22-20(21)26/h3-4,7-8,15,23H,5-6,9-13H2,1-2H3,(H,22,26)/t15-,21+/m1/s1 |
| InChIKey | RUCABFBBBLTRIV-VFNWGFHPSA-N |
| XLogP | 2.93 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|