C13H14N2O — CID 174537778
N-(2,3,4,9-tetrahydro-1H-carbazol-2-ylmethylidene)hydroxylamine (PubChem CID 174537778) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N-(2,3,4,9-tetrahydro-1H-carbazol-2-ylmethylidene)hydroxylamine.
| Compound Name | N-(2,3,4,9-tetrahydro-1H-carbazol-2-ylmethylidene)hydroxylamine |
|---|---|
| PubChem CID | 174537778 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-(2,3,4,9-tetrahydro-1H-carbazol-2-ylmethylidene)hydroxylamine |
| SMILES | ON=CC1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C13H14N2O/c16-14-8-9-5-6-11-10-3-1-2-4-12(10)15-13(11)7-9/h1-4,8-9,15-16H,5-7H2 |
| InChIKey | JUESOQCKKDNQMW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|