C12H13IN2 — CID 71178701
(1R)-1-iodo-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 71178701) has the molecular formula C12H13IN2 and a molecular weight of 312.15 g/mol. Its IUPAC name is (1R)-1-iodo-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-1-iodo-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 71178701 |
| Molecular Formula | C12H13IN2 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | (1R)-1-iodo-1-methyl-2,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@]1(I)NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C12H13IN2/c1-12(13)11-9(6-7-14-12)8-4-2-3-5-10(8)15-11/h2-5,14-15H,6-7H2,1H3/t12-/m0/s1 |
| InChIKey | PCGUEFCGYCSUAK-LBPRGKRZSA-N |
| XLogP | 2.92 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|