C15H18N2S — CID 10332756
spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-thiane] (PubChem CID 10332756) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-thiane].
| Compound Name | spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-thiane] |
|---|---|
| PubChem CID | 10332756 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-thiane] |
| SMILES | c1ccc2c3c([nH]c2c1)C1(CCSCC1)NCC3 |
| InChI | InChI=1S/C15H18N2S/c1-2-4-13-11(3-1)12-5-8-16-15(14(12)17-13)6-9-18-10-7-15/h1-4,16-17H,5-10H2 |
| InChIKey | QZLYWAYPRARMDB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |