C17H22N2 — CID 39902695
(1S,3'S)-3'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane] (PubChem CID 39902695) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (1S,3'S)-3'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane].
| Compound Name | (1S,3'S)-3'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane] |
|---|---|
| PubChem CID | 39902695 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (1S,3'S)-3'-methylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,1'-cyclohexane] |
| SMILES | C[C@H]1CCC[C@@]2(C1)NCCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2/c1-12-5-4-9-17(11-12)16-14(8-10-18-17)13-6-2-3-7-15(13)19-16/h2-3,6-7,12,18-19H,4-5,8-11H2,1H3/t12-,17-/m0/s1 |
| InChIKey | LPEYZMKDCFQJKR-SJCJKPOMSA-N |
| XLogP | 3.72 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |