C26H32FN3O — CID 143182001
2'-[(dimethylamino)methyl]-1'-(6-fluorocyclohepta-1,3,6-trien-1-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol (PubChem CID 143182001) has the molecular formula C26H32FN3O and a molecular weight of 421.56 g/mol. Its IUPAC name is 2'-[(dimethylamino)methyl]-1'-(6-fluorocyclohepta-1,3,6-trien-1-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol.
| Compound Name | 2'-[(dimethylamino)methyl]-1'-(6-fluorocyclohepta-1,3,6-trien-1-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol |
|---|---|
| PubChem CID | 143182001 |
| Molecular Formula | C26H32FN3O |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2'-[(dimethylamino)methyl]-1'-(6-fluorocyclohepta-1,3,6-trien-1-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-cyclohexane]-1'-ol |
| SMILES | CN(C)CC1CC2(CCC1(O)C1=CC=CCC(F)=C1)NCCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C26H32FN3O/c1-30(2)17-19-16-25(12-13-26(19,31)18-7-3-4-8-20(27)15-18)24-22(11-14-28-25)21-9-5-6-10-23(21)29-24/h3-7,9-10,15,19,28-29,31H,8,11-14,16-17H2,1-2H3 |
| InChIKey | APJMAEMHCNAOMF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |