C20H27N3O — CID 110197708
2,2-dimethyl-1-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylpropan-1-one (PubChem CID 110197708) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 2,2-dimethyl-1-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylpropan-1-one.
| Compound Name | 2,2-dimethyl-1-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylpropan-1-one |
|---|---|
| PubChem CID | 110197708 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2,2-dimethyl-1-spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-ylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCC2(CC1)NCCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C20H27N3O/c1-19(2,3)18(24)23-12-9-20(10-13-23)17-15(8-11-21-20)14-6-4-5-7-16(14)22-17/h4-7,21-22H,8-13H2,1-3H3 |
| InChIKey | VGUUHTAAFIRKKE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |