C11H10S2 — CID 154337332
3,4-dihydro-1H-thiopyrano[3,4-b][1]benzothiole (PubChem CID 154337332) has the molecular formula C11H10S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,4-dihydro-1H-thiopyrano[3,4-b][1]benzothiole.
| Compound Name | 3,4-dihydro-1H-thiopyrano[3,4-b][1]benzothiole |
|---|---|
| PubChem CID | 154337332 |
| Molecular Formula | C11H10S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 3,4-dihydro-1H-thiopyrano[3,4-b][1]benzothiole |
| SMILES | c1ccc2c3c(sc2c1)CSCC3 |
| InChI | InChI=1S/C11H10S2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-4H,5-7H2 |
| InChIKey | JYYGRONLNKSPHT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |