C11H8OS — CID 57349543
2,3-dihydrocyclopenta[b][1]benzothiol-1-one (PubChem CID 57349543) has the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. Its IUPAC name is 2,3-dihydrocyclopenta[b][1]benzothiol-1-one.
| Compound Name | 2,3-dihydrocyclopenta[b][1]benzothiol-1-one |
|---|---|
| PubChem CID | 57349543 |
| Molecular Formula | C11H8OS |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2,3-dihydrocyclopenta[b][1]benzothiol-1-one |
| SMILES | O=C1CCc2sc3ccccc3c21 |
| InChI | InChI=1S/C11H8OS/c12-8-5-6-10-11(8)7-3-1-2-4-9(7)13-10/h1-4H,5-6H2 |
| InChIKey | VUQNVBHDBXJWMA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |