C11H8S2 — CID 141092483
1H-thiopyrano[3,4-b][1]benzothiole (PubChem CID 141092483) has the molecular formula C11H8S2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1H-thiopyrano[3,4-b][1]benzothiole.
| Compound Name | 1H-thiopyrano[3,4-b][1]benzothiole |
|---|---|
| PubChem CID | 141092483 |
| Molecular Formula | C11H8S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 1H-thiopyrano[3,4-b][1]benzothiole |
| SMILES | C1=Cc2c(sc3ccccc23)CS1 |
| InChI | InChI=1S/C11H8S2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-6H,7H2 |
| InChIKey | USXRPYPMTRGUND-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |