C16H12ClNS — CID 143017928
6H-[1]benzothiolo[3,2-c][1]benzazepine;hydrochloride (PubChem CID 143017928) has the molecular formula C16H12ClNS and a molecular weight of 285.80 g/mol. Its IUPAC name is 6H-[1]benzothiolo[3,2-c][1]benzazepine;hydrochloride.
| Compound Name | 6H-[1]benzothiolo[3,2-c][1]benzazepine;hydrochloride |
|---|---|
| PubChem CID | 143017928 |
| Molecular Formula | C16H12ClNS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 6H-[1]benzothiolo[3,2-c][1]benzazepine;hydrochloride |
| SMILES | C1=Nc2ccccc2Cc2sc3ccccc3c21.Cl |
| InChI | InChI=1S/C16H11NS.ClH/c1-3-7-14-11(5-1)9-16-13(10-17-14)12-6-2-4-8-15(12)18-16;/h1-8,10H,9H2;1H |
| InChIKey | ZAYHFAGANLLUAF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |