C9H5NS2 — CID 14933191
[1]benzothiolo[3,2-c][1,2]thiazole (PubChem CID 14933191) has the molecular formula C9H5NS2 and a molecular weight of 191.28 g/mol. Its IUPAC name is [1]benzothiolo[3,2-c][1,2]thiazole.
| Compound Name | [1]benzothiolo[3,2-c][1,2]thiazole |
|---|---|
| PubChem CID | 14933191 |
| Molecular Formula | C9H5NS2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | [1]benzothiolo[3,2-c][1,2]thiazole |
| SMILES | c1ccc2c(c1)sc1csnc12 |
| InChI | InChI=1S/C9H5NS2/c1-2-4-7-6(3-1)9-8(12-7)5-11-10-9/h1-5H |
| InChIKey | PWZUBRQDGLAJNP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |