C13H11NS — CID 172684607
2,3-dimethyl-[1]benzothiolo[3,2-b]pyridine (PubChem CID 172684607) has the molecular formula C13H11NS and a molecular weight of 213.30 g/mol. Its IUPAC name is 2,3-dimethyl-[1]benzothiolo[3,2-b]pyridine.
| Compound Name | 2,3-dimethyl-[1]benzothiolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 172684607 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2,3-dimethyl-[1]benzothiolo[3,2-b]pyridine |
| SMILES | Cc1cc2sc3ccccc3c2nc1C |
| InChI | InChI=1S/C13H11NS/c1-8-7-12-13(14-9(8)2)10-5-3-4-6-11(10)15-12/h3-7H,1-2H3 |
| InChIKey | AWDQEUVUNQPLNN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |