C14H15NS — CID 145072070
ethane;2-methyl-[1]benzothiolo[3,2-b]pyridine (PubChem CID 145072070) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is ethane;2-methyl-[1]benzothiolo[3,2-b]pyridine.
| Compound Name | ethane;2-methyl-[1]benzothiolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 145072070 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | ethane;2-methyl-[1]benzothiolo[3,2-b]pyridine |
| SMILES | CC.Cc1ccc2sc3ccccc3c2n1 |
| InChI | InChI=1S/C12H9NS.C2H6/c1-8-6-7-11-12(13-8)9-4-2-3-5-10(9)14-11;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | MQIDUCRAGPEDQJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |