C12H9NS — CID 15441450
2-methyl-[1]benzothiolo[3,2-b]pyridine (PubChem CID 15441450) has the molecular formula C12H9NS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-methyl-[1]benzothiolo[3,2-b]pyridine.
| Compound Name | 2-methyl-[1]benzothiolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 15441450 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-methyl-[1]benzothiolo[3,2-b]pyridine |
| SMILES | Cc1ccc2sc3ccccc3c2n1 |
| InChI | InChI=1S/C12H9NS/c1-8-6-7-11-12(13-8)9-4-2-3-5-10(9)14-11/h2-7H,1H3 |
| InChIKey | TUSKDXVNNFTKMJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |