C11H7FN2S — CID 118245250
2-fluoro-4-methyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 118245250) has the molecular formula C11H7FN2S and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-fluoro-4-methyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-fluoro-4-methyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 118245250 |
| Molecular Formula | C11H7FN2S |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-fluoro-4-methyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(F)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C11H7FN2S/c1-6-10-9(14-11(12)13-6)7-4-2-3-5-8(7)15-10/h2-5H,1H3 |
| InChIKey | BVLXMPFXFGVVAM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |