C13H12N2S — CID 144594588
2-ethyl-4-methyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 144594588) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-ethyl-4-methyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-ethyl-4-methyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 144594588 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-ethyl-4-methyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | CCc1nc(C)c2sc3ccccc3c2n1 |
| InChI | InChI=1S/C13H12N2S/c1-3-11-14-8(2)13-12(15-11)9-6-4-5-7-10(9)16-13/h4-7H,3H2,1-2H3 |
| InChIKey | OUNLYPHWPSLDKG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |