C17H10ClNS — CID 90196949
4-chloro-2-phenyl-[1]benzothiolo[3,2-b]pyridine (PubChem CID 90196949) has the molecular formula C17H10ClNS and a molecular weight of 295.79 g/mol. Its IUPAC name is 4-chloro-2-phenyl-[1]benzothiolo[3,2-b]pyridine.
| Compound Name | 4-chloro-2-phenyl-[1]benzothiolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 90196949 |
| Molecular Formula | C17H10ClNS |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-chloro-2-phenyl-[1]benzothiolo[3,2-b]pyridine |
| SMILES | Clc1cc(-c2ccccc2)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C17H10ClNS/c18-13-10-14(11-6-2-1-3-7-11)19-16-12-8-4-5-9-15(12)20-17(13)16/h1-10H |
| InChIKey | FMHSTYHILHMDHT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |