C17H11NS — CID 69206815
2-phenyl-[1]benzothiolo[3,2-b]pyridine (PubChem CID 69206815) has the molecular formula C17H11NS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-phenyl-[1]benzothiolo[3,2-b]pyridine.
| Compound Name | 2-phenyl-[1]benzothiolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 69206815 |
| Molecular Formula | C17H11NS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-phenyl-[1]benzothiolo[3,2-b]pyridine |
| SMILES | c1ccc(-c2ccc3sc4ccccc4c3n2)cc1 |
| InChI | InChI=1S/C17H11NS/c1-2-6-12(7-3-1)14-10-11-16-17(18-14)13-8-4-5-9-15(13)19-16/h1-11H |
| InChIKey | BDSJSZACNRJFNI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |