C18H22N2S — CID 164819464
2,4-ditert-butyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 164819464) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 2,4-ditert-butyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2,4-ditert-butyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 164819464 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2,4-ditert-butyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | CC(C)(C)c1nc(C(C)(C)C)c2sc3ccccc3c2n1 |
| InChI | InChI=1S/C18H22N2S/c1-17(2,3)15-14-13(19-16(20-15)18(4,5)6)11-9-7-8-10-12(11)21-14/h7-10H,1-6H3 |
| InChIKey | ZQTOUPJRAUEONP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |