C10H6ClN3S — CID 130222145
2-chloro-[1]benzothiolo[3,2-d]pyrimidin-4-amine (PubChem CID 130222145) has the molecular formula C10H6ClN3S and a molecular weight of 235.70 g/mol. Its IUPAC name is 2-chloro-[1]benzothiolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130222145 |
| Molecular Formula | C10H6ClN3S |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 2-chloro-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1nc(Cl)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C10H6ClN3S/c11-10-13-7-5-3-1-2-4-6(5)15-8(7)9(12)14-10/h1-4H,(H2,12,13,14) |
| InChIKey | YGHPKVLSBBUUPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |