C10H5ClN2S — CID 821835
4-chloro-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 821835) has the molecular formula C10H5ClN2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 4-chloro-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-chloro-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 821835 |
| Molecular Formula | C10H5ClN2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 4-chloro-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Clc1ncnc2c1sc1ccccc12 |
| InChI | InChI=1S/C10H5ClN2S/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9/h1-5H |
| InChIKey | GRJAFENSUSLYET-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |