C11H9N3S2 — CID 820647
4-methylsulfanyl-[1]benzothiolo[3,2-d]pyrimidin-2-amine (PubChem CID 820647) has the molecular formula C11H9N3S2 and a molecular weight of 247.35 g/mol. Its IUPAC name is 4-methylsulfanyl-[1]benzothiolo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-methylsulfanyl-[1]benzothiolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 820647 |
| Molecular Formula | C11H9N3S2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4-methylsulfanyl-[1]benzothiolo[3,2-d]pyrimidin-2-amine |
| SMILES | CSc1nc(N)nc2c1sc1ccccc12 |
| InChI | InChI=1S/C11H9N3S2/c1-15-10-9-8(13-11(12)14-10)6-4-2-3-5-7(6)16-9/h2-5H,1H3,(H2,12,13,14) |
| InChIKey | KYFQIYCLZIZSHA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |