About ethane;4-ethyldibenzothiophene
ethane;4-ethyldibenzothiophene (PubChem CID 123227550) has the molecular formula C18H24S
and a molecular weight of 272.46 g/mol. Its IUPAC name is ethane;4-ethyldibenzothiophene.
Molecular Properties
| Compound Name | ethane;4-ethyldibenzothiophene |
| PubChem CID | 123227550 |
| Molecular Formula | C18H24S |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | ethane;4-ethyldibenzothiophene |
| SMILES | CC.CC.CCc1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C14H12S.2C2H6/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;2*1-2/h3-9H,2H2,1H3;2*1-2H3 |
| InChIKey | HQLAVPARQUFUPN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-ethyldibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyldibenzothiophene?
The IUPAC name of ethane;4-ethyldibenzothiophene (CID 123227550) is ethane;4-ethyldibenzothiophene.
What is the SMILES notation for ethane;4-ethyldibenzothiophene?
The canonical SMILES for ethane;4-ethyldibenzothiophene is CC.CC.CCc1cccc2c1sc1ccccc12.
What is the InChIKey of ethane;4-ethyldibenzothiophene?
The InChIKey is HQLAVPARQUFUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12S.2C2H6/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12;2*1-2/h3-9H,2H2,1H3;2*1-2H3.
What are the key properties of ethane;4-ethyldibenzothiophene?
ethane;4-ethyldibenzothiophene has a molecular weight of 272.46 g/mol, XLogP of 6.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyldibenzothiophene is sourced from PubChem (CID 123227550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).