About lithium;butane;6-ethyldibenzothiophen-4-ol
lithium;butane;6-ethyldibenzothiophen-4-ol (PubChem CID 87765195) has the molecular formula C18H21LiOS
and a molecular weight of 292.37 g/mol. Its IUPAC name is lithium;butane;6-ethyldibenzothiophen-4-ol.
Molecular Properties
| Compound Name | lithium;butane;6-ethyldibenzothiophen-4-ol |
| PubChem CID | 87765195 |
| Molecular Formula | C18H21LiOS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | lithium;butane;6-ethyldibenzothiophen-4-ol |
| SMILES | CCc1cccc2c1sc1c(O)cccc12.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C14H12OS.C4H9.Li/c1-2-9-5-3-6-10-11-7-4-8-12(15)14(11)16-13(9)10;1-3-4-2;/h3-8,15H,2H2,1H3;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | BSGIKODIBLENKE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;butane;6-ethyldibenzothiophen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;butane;6-ethyldibenzothiophen-4-ol?
The IUPAC name of lithium;butane;6-ethyldibenzothiophen-4-ol (CID 87765195) is lithium;butane;6-ethyldibenzothiophen-4-ol.
What is the SMILES notation for lithium;butane;6-ethyldibenzothiophen-4-ol?
The canonical SMILES for lithium;butane;6-ethyldibenzothiophen-4-ol is CCc1cccc2c1sc1c(O)cccc12.[CH2-]CCC.[Li+].
What is the InChIKey of lithium;butane;6-ethyldibenzothiophen-4-ol?
The InChIKey is BSGIKODIBLENKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12OS.C4H9.Li/c1-2-9-5-3-6-10-11-7-4-8-12(15)14(11)16-13(9)10;1-3-4-2;/h3-8,15H,2H2,1H3;1,3-4H2,2H3;/q;-1;+1.
What are the key properties of lithium;butane;6-ethyldibenzothiophen-4-ol?
lithium;butane;6-ethyldibenzothiophen-4-ol has a molecular weight of 292.37 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;butane;6-ethyldibenzothiophen-4-ol is sourced from PubChem (CID 87765195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).