About 2-butoxy-3-ethylphenol
2-butoxy-3-ethylphenol (PubChem CID 67732111) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-butoxy-3-ethylphenol.
Molecular Properties
| Compound Name | 2-butoxy-3-ethylphenol |
| PubChem CID | 67732111 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-butoxy-3-ethylphenol |
| SMILES | CCCCOc1c(O)cccc1CC |
| InChI | InChI=1S/C12H18O2/c1-3-5-9-14-12-10(4-2)7-6-8-11(12)13/h6-8,13H,3-5,9H2,1-2H3 |
| InChIKey | PVJVZASCSDKABV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3-ethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3-ethylphenol?
The IUPAC name of 2-butoxy-3-ethylphenol (CID 67732111) is 2-butoxy-3-ethylphenol.
What is the SMILES notation for 2-butoxy-3-ethylphenol?
The canonical SMILES for 2-butoxy-3-ethylphenol is CCCCOc1c(O)cccc1CC.
What is the InChIKey of 2-butoxy-3-ethylphenol?
The InChIKey is PVJVZASCSDKABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-3-5-9-14-12-10(4-2)7-6-8-11(12)13/h6-8,13H,3-5,9H2,1-2H3.
What are the key properties of 2-butoxy-3-ethylphenol?
2-butoxy-3-ethylphenol has a molecular weight of 194.27 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3-ethylphenol is sourced from PubChem (CID 67732111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).