About 2-butoxy-3-butylbenzoic acid
2-butoxy-3-butylbenzoic acid (PubChem CID 22223226) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-butoxy-3-butylbenzoic acid.
Molecular Properties
| Compound Name | 2-butoxy-3-butylbenzoic acid |
| PubChem CID | 22223226 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-butoxy-3-butylbenzoic acid |
| SMILES | CCCCOc1c(CCCC)cccc1C(=O)O |
| InChI | InChI=1S/C15H22O3/c1-3-5-8-12-9-7-10-13(15(16)17)14(12)18-11-6-4-2/h7,9-10H,3-6,8,11H2,1-2H3,(H,16,17) |
| InChIKey | ODBSXPPIGCUMQR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3-butylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3-butylbenzoic acid?
The IUPAC name of 2-butoxy-3-butylbenzoic acid (CID 22223226) is 2-butoxy-3-butylbenzoic acid.
What is the SMILES notation for 2-butoxy-3-butylbenzoic acid?
The canonical SMILES for 2-butoxy-3-butylbenzoic acid is CCCCOc1c(CCCC)cccc1C(=O)O.
What is the InChIKey of 2-butoxy-3-butylbenzoic acid?
The InChIKey is ODBSXPPIGCUMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-3-5-8-12-9-7-10-13(15(16)17)14(12)18-11-6-4-2/h7,9-10H,3-6,8,11H2,1-2H3,(H,16,17).
What are the key properties of 2-butoxy-3-butylbenzoic acid?
2-butoxy-3-butylbenzoic acid has a molecular weight of 250.34 g/mol, XLogP of 3.91, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3-butylbenzoic acid is sourced from PubChem (CID 22223226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).