About 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine
3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine (PubChem CID 66601021) has the molecular formula C24H31N3O3
and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine.
Molecular Properties
| Compound Name | 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine |
| PubChem CID | 66601021 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine |
| SMILES | CCCCCCOc1c(O)cccc1CC.COc1cnnnc1-c1ccccc1 |
| InChI | InChI=1S/C14H22O2.C10H9N3O/c1-3-5-6-7-11-16-14-12(4-2)9-8-10-13(14)15;1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8/h8-10,15H,3-7,11H2,1-2H3;2-7H,1H3 |
| InChIKey | XPSXNFUPMKXMLB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
The IUPAC name of 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine (CID 66601021) is 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine.
What is the SMILES notation for 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
The canonical SMILES for 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine is CCCCCCOc1c(O)cccc1CC.COc1cnnnc1-c1ccccc1.
What is the InChIKey of 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
The InChIKey is XPSXNFUPMKXMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2.C10H9N3O/c1-3-5-6-7-11-16-14-12(4-2)9-8-10-13(14)15;1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8/h8-10,15H,3-7,11H2,1-2H3;2-7H,1H3.
What are the key properties of 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine has a molecular weight of 409.53 g/mol, XLogP of 5.46, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine is sourced from PubChem (CID 66601021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).