C26H35N3O3 — CID 66902350
3,4-diethyl-2-hexoxyphenol;4-(2-methoxyphenyl)triazine (PubChem CID 66902350) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 3,4-diethyl-2-hexoxyphenol;4-(2-methoxyphenyl)triazine.
| Compound Name | 3,4-diethyl-2-hexoxyphenol;4-(2-methoxyphenyl)triazine |
|---|---|
| PubChem CID | 66902350 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 3,4-diethyl-2-hexoxyphenol;4-(2-methoxyphenyl)triazine |
| SMILES | CCCCCCOc1c(O)ccc(CC)c1CC.COc1ccccc1-c1ccnnn1 |
| InChI | InChI=1S/C16H26O2.C10H9N3O/c1-4-7-8-9-12-18-16-14(6-3)13(5-2)10-11-15(16)17;1-14-10-5-3-2-4-8(10)9-6-7-11-13-12-9/h10-11,17H,4-9,12H2,1-3H3;2-7H,1H3 |
| InChIKey | KYLWMDXCISPQHM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|