C21H33N3O3 — CID 90302238
3,4-diethyl-2-hexoxyphenol;4-(methoxymethyl)triazine (PubChem CID 90302238) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 3,4-diethyl-2-hexoxyphenol;4-(methoxymethyl)triazine.
| Compound Name | 3,4-diethyl-2-hexoxyphenol;4-(methoxymethyl)triazine |
|---|---|
| PubChem CID | 90302238 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 3,4-diethyl-2-hexoxyphenol;4-(methoxymethyl)triazine |
| SMILES | CCCCCCOc1c(O)ccc(CC)c1CC.COCc1ccnnn1 |
| InChI | InChI=1S/C16H26O2.C5H7N3O/c1-4-7-8-9-12-18-16-14(6-3)13(5-2)10-11-15(16)17;1-9-4-5-2-3-6-8-7-5/h10-11,17H,4-9,12H2,1-3H3;2-3H,4H2,1H3 |
| InChIKey | CJSRIAGPOXBZHC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|