About 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine
5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine (PubChem CID 87522650) has the molecular formula C24H31N3O3
and a molecular weight of 409.53 g/mol. Its IUPAC name is 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine.
Molecular Properties
| Compound Name | 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine |
| PubChem CID | 87522650 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine |
| SMILES | CCCCCCOc1c(CC)cc(O)c(OC)c1-c1ccccc1.c1cnnnc1 |
| InChI | InChI=1S/C21H28O3.C3H3N3/c1-4-6-7-11-14-24-20-16(5-2)15-18(22)21(23-3)19(20)17-12-9-8-10-13-17;1-2-4-6-5-3-1/h8-10,12-13,15,22H,4-7,11,14H2,1-3H3;1-3H |
| InChIKey | INIWHKYRADRPCP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine?
The IUPAC name of 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine (CID 87522650) is 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine.
What is the SMILES notation for 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine?
The canonical SMILES for 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine is CCCCCCOc1c(CC)cc(O)c(OC)c1-c1ccccc1.c1cnnnc1.
What is the InChIKey of 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine?
The InChIKey is INIWHKYRADRPCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O3.C3H3N3/c1-4-6-7-11-14-24-20-16(5-2)15-18(22)21(23-3)19(20)17-12-9-8-10-13-17;1-2-4-6-5-3-1/h8-10,12-13,15,22H,4-7,11,14H2,1-3H3;1-3H.
What are the key properties of 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine?
5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine has a molecular weight of 409.53 g/mol, XLogP of 5.46, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-hexoxy-2-methoxy-3-phenylphenol;triazine is sourced from PubChem (CID 87522650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).