About 2-ethyl-3-hexoxyphenol
2-ethyl-3-hexoxyphenol (PubChem CID 118561746) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-ethyl-3-hexoxyphenol.
Molecular Properties
| Compound Name | 2-ethyl-3-hexoxyphenol |
| PubChem CID | 118561746 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-ethyl-3-hexoxyphenol |
| SMILES | CCCCCCOc1cccc(O)c1CC |
| InChI | InChI=1S/C14H22O2/c1-3-5-6-7-11-16-14-10-8-9-13(15)12(14)4-2/h8-10,15H,3-7,11H2,1-2H3 |
| InChIKey | HNMWSWXENFAUJA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-hexoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-hexoxyphenol?
The IUPAC name of 2-ethyl-3-hexoxyphenol (CID 118561746) is 2-ethyl-3-hexoxyphenol.
What is the SMILES notation for 2-ethyl-3-hexoxyphenol?
The canonical SMILES for 2-ethyl-3-hexoxyphenol is CCCCCCOc1cccc(O)c1CC.
What is the InChIKey of 2-ethyl-3-hexoxyphenol?
The InChIKey is HNMWSWXENFAUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-3-5-6-7-11-16-14-10-8-9-13(15)12(14)4-2/h8-10,15H,3-7,11H2,1-2H3.
What are the key properties of 2-ethyl-3-hexoxyphenol?
2-ethyl-3-hexoxyphenol has a molecular weight of 222.33 g/mol, XLogP of 3.91, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-hexoxyphenol is sourced from PubChem (CID 118561746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).