About 2,6-diheptoxyphenol
2,6-diheptoxyphenol (PubChem CID 57426104) has the molecular formula C20H34O3
and a molecular weight of 322.49 g/mol. Its IUPAC name is 2,6-diheptoxyphenol.
Molecular Properties
| Compound Name | 2,6-diheptoxyphenol |
| PubChem CID | 57426104 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2,6-diheptoxyphenol |
| SMILES | CCCCCCCOc1cccc(OCCCCCCC)c1O |
| InChI | InChI=1S/C20H34O3/c1-3-5-7-9-11-16-22-18-14-13-15-19(20(18)21)23-17-12-10-8-6-4-2/h13-15,21H,3-12,16-17H2,1-2H3 |
| InChIKey | XBQPURHFVHTECH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diheptoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diheptoxyphenol?
The IUPAC name of 2,6-diheptoxyphenol (CID 57426104) is 2,6-diheptoxyphenol.
What is the SMILES notation for 2,6-diheptoxyphenol?
The canonical SMILES for 2,6-diheptoxyphenol is CCCCCCCOc1cccc(OCCCCCCC)c1O.
What is the InChIKey of 2,6-diheptoxyphenol?
The InChIKey is XBQPURHFVHTECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O3/c1-3-5-7-9-11-16-22-18-14-13-15-19(20(18)21)23-17-12-10-8-6-4-2/h13-15,21H,3-12,16-17H2,1-2H3.
What are the key properties of 2,6-diheptoxyphenol?
2,6-diheptoxyphenol has a molecular weight of 322.49 g/mol, XLogP of 6.09, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diheptoxyphenol is sourced from PubChem (CID 57426104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).