C26H37N3O3 — CID 175431463
1,4-diethyl-6-hexoxycyclohexa-2,4-dien-1-ol;5-methoxy-4-phenyltriazine (PubChem CID 175431463) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1,4-diethyl-6-hexoxycyclohexa-2,4-dien-1-ol;5-methoxy-4-phenyltriazine.
| Compound Name | 1,4-diethyl-6-hexoxycyclohexa-2,4-dien-1-ol;5-methoxy-4-phenyltriazine |
|---|---|
| PubChem CID | 175431463 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 1,4-diethyl-6-hexoxycyclohexa-2,4-dien-1-ol;5-methoxy-4-phenyltriazine |
| SMILES | CCCCCCOC1C=C(CC)C=CC1(O)CC.COc1cnnnc1-c1ccccc1 |
| InChI | InChI=1S/C16H28O2.C10H9N3O/c1-4-7-8-9-12-18-15-13-14(5-2)10-11-16(15,17)6-3;1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8/h10-11,13,15,17H,4-9,12H2,1-3H3;2-7H,1H3 |
| InChIKey | PKYZYNXERXUYAR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|