About butyl 2-ethoxy-3-ethylbenzoate
butyl 2-ethoxy-3-ethylbenzoate (PubChem CID 141402321) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is butyl 2-ethoxy-3-ethylbenzoate.
Molecular Properties
| Compound Name | butyl 2-ethoxy-3-ethylbenzoate |
| PubChem CID | 141402321 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | butyl 2-ethoxy-3-ethylbenzoate |
| SMILES | CCCCOC(=O)c1cccc(CC)c1OCC |
| InChI | InChI=1S/C15H22O3/c1-4-7-11-18-15(16)13-10-8-9-12(5-2)14(13)17-6-3/h8-10H,4-7,11H2,1-3H3 |
| InChIKey | KJIPWPHACCSRCW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-ethoxy-3-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-ethoxy-3-ethylbenzoate?
The IUPAC name of butyl 2-ethoxy-3-ethylbenzoate (CID 141402321) is butyl 2-ethoxy-3-ethylbenzoate.
What is the SMILES notation for butyl 2-ethoxy-3-ethylbenzoate?
The canonical SMILES for butyl 2-ethoxy-3-ethylbenzoate is CCCCOC(=O)c1cccc(CC)c1OCC.
What is the InChIKey of butyl 2-ethoxy-3-ethylbenzoate?
The InChIKey is KJIPWPHACCSRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-4-7-11-18-15(16)13-10-8-9-12(5-2)14(13)17-6-3/h8-10H,4-7,11H2,1-3H3.
What are the key properties of butyl 2-ethoxy-3-ethylbenzoate?
butyl 2-ethoxy-3-ethylbenzoate has a molecular weight of 250.34 g/mol, XLogP of 3.60, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-ethoxy-3-ethylbenzoate is sourced from PubChem (CID 141402321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).