C10H5IN2S — CID 135291643
2-iodo-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 135291643) has the molecular formula C10H5IN2S and a molecular weight of 312.14 g/mol. Its IUPAC name is 2-iodo-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2-iodo-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 135291643 |
| Molecular Formula | C10H5IN2S |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.92 |
| IUPAC Name | 2-iodo-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Ic1ncc2sc3ccccc3c2n1 |
| InChI | InChI=1S/C10H5IN2S/c11-10-12-5-8-9(13-10)6-3-1-2-4-7(6)14-8/h1-5H |
| InChIKey | FYQCVFYUKOQDEG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|