C12H10N2S — CID 142468841
3-methyl-3H-[1]benzothiolo[2,3-e][1,4]diazepine (PubChem CID 142468841) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-methyl-3H-[1]benzothiolo[2,3-e][1,4]diazepine.
| Compound Name | 3-methyl-3H-[1]benzothiolo[2,3-e][1,4]diazepine |
|---|---|
| PubChem CID | 142468841 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-methyl-3H-[1]benzothiolo[2,3-e][1,4]diazepine |
| SMILES | CC1C=Nc2sc3ccccc3c2C=N1 |
| InChI | InChI=1S/C12H10N2S/c1-8-6-14-12-10(7-13-8)9-4-2-3-5-11(9)15-12/h2-8H,1H3 |
| InChIKey | FCKXLRYLVHROIR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |