C13H11ClFN3S — CID 137019948
5-chloro-6-(2-fluoro-1-benzothiophen-3-yl)-N-methyl-5,6-dihydro-1H-pyrimidin-2-imine (PubChem CID 137019948) has the molecular formula C13H11ClFN3S and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-6-(2-fluoro-1-benzothiophen-3-yl)-N-methyl-5,6-dihydro-1H-pyrimidin-2-imine.
| Compound Name | 5-chloro-6-(2-fluoro-1-benzothiophen-3-yl)-N-methyl-5,6-dihydro-1H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 137019948 |
| Molecular Formula | C13H11ClFN3S |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-chloro-6-(2-fluoro-1-benzothiophen-3-yl)-N-methyl-5,6-dihydro-1H-pyrimidin-2-imine |
| SMILES | C/N=C1\N=CC(Cl)C(c2c(F)sc3ccccc23)N1 |
| InChI | InChI=1S/C13H11ClFN3S/c1-16-13-17-6-8(14)11(18-13)10-7-4-2-3-5-9(7)19-12(10)15/h2-6,8,11H,1H3,(H,16,18) |
| InChIKey | LWCGBVFMWRTHMS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|